RefMet Compound Details
MW structure | 37902 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Isocitric acid | |
Systematic name | 1-hydroxypropane-1,2,3-tricarboxylic acid | |
SMILES | O=C(O)C[C@H](C(=O)O)[C@@H](O)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 192.027005 (neutral) |
Table of KEGG reactions in human pathways involving Isocitric acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01324 | Citrate <=> Isocitrate | citrate hydroxymutase |
R01900 | Isocitrate <=> cis-Aconitate + H2O | isocitrate hydro-lyase (cis-aconitate-forming) |
R01899 | Isocitrate + NADP+ <=> Oxalosuccinate + NADPH + H+ | Isocitrate:NADP+ oxidoreductase |
R00709 | Isocitrate + NAD+ <=> 2-Oxoglutarate + CO2 + NADH + H+ | isocitrate:NAD+ oxidoreductase (decarboxylating) |
R00267 | Isocitrate + NADP+ <=> 2-Oxoglutarate + CO2 + NADPH + H+ | Isocitrate:NADP+ oxidoreductase (decarboxylating) |
Table of KEGG human pathways containing Isocitric acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00020 | Citrate cycle (TCA cycle) | 3 |
hsa01210 | 2-Oxocarboxylic acid metabolism | 3 |
hsa00480 | Glutathione metabolism | 1 |
hsa00630 | Glyoxylate and dicarboxylate metabolism | 1 |
hsa01200 | Carbon metabolism | 1 |
hsa01230 | Biosynthesis of amino acids | 1 |