RefMet Compound Details
MW structure | 1871 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Isoleucine | |
Systematic name | 2S-Amino-3S-methylpentanoic acid | |
SMILES | CC[C@H](C)[C@@H](C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 131.094629 (neutral) |
Table of KEGG reactions in human pathways involving Isoleucine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02197 | L-Isoleucine + H2O + Oxygen <=> (S)-3-Methyl-2-oxopentanoic acid + Ammonia + Hydrogen peroxide | L-Isoleucine:oxygen oxidoreductase (deaminating) |
R02196 | L-Isoleucine + NAD+ + H2O <=> (S)-3-Methyl-2-oxopentanoic acid + Ammonia + NADH + H+ | L-Isoleucine:NAD+ oxidoreductase(deaminating) |
R02199 | L-Isoleucine + 2-Oxoglutarate <=> (S)-3-Methyl-2-oxopentanoic acid + L-Glutamate | L-Isoleucine:2-oxoglutarate aminotransferase |
R03656 | ATP + L-Isoleucine + tRNA(Ile) <=> AMP + Diphosphate + L-Isoleucyl-tRNA(Ile) | L-Isoleucine:tRNA(Ile) ligase (AMP-forming) |
Table of KEGG human pathways containing Isoleucine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 2 |
hsa00290 | Valine, leucine and isoleucine biosynthesis | 1 |
hsa00970 | Aminoacyl-tRNA biosynthesis | 1 |
hsa01100 | Metabolic pathways | 1 |
hsa01210 | 2-Oxocarboxylic acid metabolism | 1 |
hsa01230 | Biosynthesis of amino acids | 1 |