RefMet Compound Details
MW structure | 38222 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Isomaltose | |
Systematic name | (3R,4S,5S,6R)-6-({[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-2,3,4,5-tetrol | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](OC[C@@H]2[C@H]([C@@H]([C@H](C(O)O2)O)O)O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 342.116215 (neutral) |
Table of KEGG reactions in human pathways involving Isomaltose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01718 | Isomaltose + H2O <=> alpha-D-Glucose + D-Glucose | Isomaltose 6-alpha-D-glucanohydrolase |
Table of KEGG human pathways containing Isomaltose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00500 | Starch and sucrose metabolism | 1 |