RefMet Compound Details
MW structure | 38342 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | L-Gulonolactone | |
Alternative name | Gulonolactone | |
Systematic name | (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one | |
SMILES | C([C@@H]([C@@H]1[C@@H]([C@@H](C(=O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 178.047740 (neutral) |
Table of KEGG reactions in human pathways involving L-Gulonolactone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02933 | L-Gulono-1,4-lactone + H2O <=> L-Gulonate | L-Gulono-1,4-lactone lactonohydrolase |
Table of KEGG human pathways containing L-Gulonolactone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00053 | Ascorbate and aldarate metabolism | 1 |