RefMet Compound Details
RefMet name | LPC P-18:1 or LPC O-18:2 | |
---|---|---|
Alternative name | LPC(P-18:1)/LPC(O-18:2) | |
Systematic name | 1-(1Z,9Z-octadecadienyl)-sn-glycero-3-phosphocholine | |
SMILES | CCCCCCCC/C=C\CCCCCC/C=C\OC[C@@H](O)COP([O-])(=O)OCC[N+](C)(C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | LPC O-18:2 | View other entries in RefMet with this sum composition |
Exact mass | 505.353227 (neutral) |
Table of KEGG reactions in human pathways involving LPC P-18:1 or LPC O-18:2
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03438 | Acyl-CoA + 1-Organyl-2-lyso-sn-glycero-3-phosphocholine <=> CoA + 1-Radyl-2-acyl-sn-glycero-3-phosphocholine | Acyl-CoA:1-alkyl-sn-glycero-3-phosphocholine O-acyltransferase |
R03437 | Acetyl-CoA + 1-Organyl-2-lyso-sn-glycero-3-phosphocholine <=> CoA + 2-Acetyl-1-alkyl-sn-glycero-3-phosphocholine | Acetyl-CoA:1-alkyl-sn-glycero-3-phosphocholine 2-O-acetyltransferase |
R04452 | 2-Acetyl-1-alkyl-sn-glycero-3-phosphocholine + H2O <=> 1-Organyl-2-lyso-sn-glycero-3-phosphocholine + Acetate | 1-Alkyl-2-acetyl-sn-glycero-3-phosphocholine acetohydrolase |
R07387 | 1-Radyl-2-acyl-sn-glycero-3-phosphocholine + H2O <=> 1-Organyl-2-lyso-sn-glycero-3-phosphocholine + Carboxylate | plasmanylcholine 2-acylhydrolase |
Table of KEGG human pathways containing LPC P-18:1 or LPC O-18:2
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00565 | Ether lipid metabolism | 4 |