RefMet Compound Details
MW structure | 46161 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Linamarin | |
Systematic name | 2-methyl-2-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}propanenitrile | |
SMILES | CC(C)(C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 247.105589 (neutral) |
Table of KEGG reactions in human pathways involving Linamarin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R10040 | Linamarin + H2O <=> Acetone cyanohydrin + beta-D-Glucose | beta-D-glucoside glucohydrolase |
R03625 | UDP-glucose + Acetone cyanohydrin <=> UDP + Linamarin | UDPglucose:2-hydroxy-2-methylpropanenitrile beta-D-glucosyltransferase |
Table of KEGG human pathways containing Linamarin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 2 |