RefMet Compound Details
MW structure | 553 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Linoleic acid | |
Alternative name | FA 18:2(9Z,12Z) | |
Systematic name | 9Z,12Z-octadecadienoic acid | |
SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | FA 18:2 | View other entries in RefMet with this sum composition |
Exact mass | 280.240230 (neutral) |
Table of KEGG reactions in human pathways involving Linoleic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07055 | Linoleate + Oxygen + NADPH + H+ <=> 9(10)-EpOME + NADP+ + H2O | Linoleate + Oxygen + NADPH + H+ <=> 9(10)-EpOME + NADP+ + H2O |
R07056 | Linoleate + Oxygen + NADPH + H+ <=> 12(13)-EpOME + NADP+ + H2O | Linoleate + Oxygen + NADPH + H+ <=> 12(13)-EpOME + NADP+ + H2O |
R07064 | Phosphatidylcholine + H2O <=> 1-Acyl-sn-glycero-3-phosphocholine + Linoleate | phosphatidylcholine 2-acylhydrolase |
R08177 | Linoleoyl-CoA + H2O <=> CoA + Linoleate | Linoleoyl-CoA hydrolase |
R03626 | Linoleate + Oxygen <=> (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoic acid | Linoleate:oxygen 13-oxidoreductase |
Table of KEGG human pathways containing Linoleic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00591 | Linoleic acid metabolism | 4 |
hsa01040 | Biosynthesis of unsaturated fatty acids | 1 |