RefMet Compound Details
MW structure | 5774 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | MG 0:0/18:1(9Z)/0:0 | |
Alternative name | MG(0:0/18:1(9Z)/0:0) | |
Systematic name | 2-(9Z-octadecenoyl)-sn-glycerol | |
SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CO)CO Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | MG 18:1 | View other entries in RefMet with this sum composition |
Exact mass | 356.292660 (neutral) |
Table of KEGG reactions in human pathways involving MG 0:0/18:1(9Z)/0:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03756 | 2,3-Dehydroacyl-CoA + 1-Acylglycerol <=> CoA + 1,2-Diacyl-sn-glycerol | 2,3-dehydroacyl-CoA:2-acylglycerol O-acyltransferase |
R01351 | 1-Acylglycerol + H2O <=> Glycerol + Fatty acid | 1-acylglycerol acylhydrolase |
R02687 | 1,2-Diacyl-sn-glycerol + H2O <=> 1-Acylglycerol + Fatty acid | 1,2-diacyl-sn-glycerol acylhydrolase |
R02757 | ATP + 1-Acylglycerol <=> ADP + 1-Acyl-sn-glycerol 3-phosphate | ATP:acylglycerol 3-phosphotransferase |
R11527 | 1-Acyl-sn-glycerol 3-phosphate + H2O <=> 1-Acylglycerol + Orthophosphate | 1-acyl-sn-glycerol 3-phosphate phosphohydrolase |
R03755 | Acyl-CoA + 1-Acylglycerol <=> CoA + 1,2-Diacyl-sn-glycerol | acyl-CoA:2-acylglycerol O-acyltransferase |
Table of KEGG human pathways containing MG 0:0/18:1(9Z)/0:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00561 | Glycerolipid metabolism | 5 |
hsa01100 | Metabolic pathways | 3 |