RefMet Compound Details
MW structure | 37115 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Mannose | |
Systematic name | (3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@@H](C(O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 180.063390 (neutral) |
Table of KEGG reactions in human pathways involving Mannose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01326 | ATP + D-Mannose <=> ADP + D-Mannose 6-phosphate | ATP:D-mannose 6-phosphotransferase |
R02630 | Protein N(pi)-phospho-L-histidine + D-Mannose <=> Protein histidine + D-Mannose 6-phosphate | protein-N(pi)-phosphohistidine:D-mannose 6-phosphotransferase |
Table of KEGG human pathways containing Mannose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00051 | Fructose and mannose metabolism | 1 |
hsa00052 | Galactose metabolism | 1 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |