RefMet Compound Details

MW structure37371 (View MW Metabolite Database details)
RefMet nameMethionine
Systematic name(2S)-2-amino-4-(methylsulfanyl)butanoic acid
SMILESCSCC[C@H](N)C(=O)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass149.051051 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC5H11NO2SView other entries in RefMet with this formula
InChIInChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1
InChIKeyFFEARJCKVFRZRR-BYPYZUCNSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID6137
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)
Human quantitationView measurements in targeted assays on human samples

Table of KEGG reactions in human pathways involving Methionine

Rxn IDKEGG ReactionEnzyme
R02821 Betaine + L-Homocysteine <=> N,N-Dimethylglycine + L-MethionineTrimethylaminoacetate:L-homosysteine S-methyltransferase
R07396 4-Methylthio-2-oxobutanoic acid + L-Glutamate <=> L-Methionine + 2-Oxoglutarate4-Methylthio-2-oxobutanoic acid + L-Glutamate <=> L-Methionine + 2-Oxoglutarate
R00177 Orthophosphate + Diphosphate + S-Adenosyl-L-methionine <=> ATP + L-Methionine + H2OATP:L-methionine S-adenosyltransferase
R00946 5-Methyltetrahydrofolate + L-Homocysteine <=> Tetrahydrofolate + L-Methionine5-Methyltetrahydrofolate:L-homocysteine S-methyltransferase
R03659 ATP + L-Methionine + tRNA(Met) <=> AMP + Diphosphate + L-Methionyl-tRNAL-Methionine:tRNAMet ligase (AMP-forming)
R00650 S-Adenosyl-L-methionine + L-Homocysteine <=> S-Adenosyl-L-homocysteine + L-MethionineS-Adenosyl-L-methionine:L-homocysteine S-methyltransferase
R04405 5-Methyltetrahydropteroyltri-L-glutamate + L-Homocysteine <=> Tetrahydropteroyltri-L-glutamate + L-Methionine5-Methyltetrahydropteroyltri-L-glutamate:L-homocysteine S-methyltransferase
R12055 L-Methionine + Indolepyruvate <=> 4-Methylthio-2-oxobutanoic acid + L-TryptophanL-methionine:indole-3-pyruvic acid aminotransferase
R00648 L-Methionine + H2O + Oxygen <=> 4-Methylthio-2-oxobutanoic acid + Ammonia + Hydrogen peroxideL-Methionine:oxygen oxidoreductase (deaminating)

Table of KEGG human pathways containing Methionine

Pathway IDHuman Pathway# of reactions
hsa00270 Cysteine and methionine metabolism 6
hsa01100 Metabolic pathways 2
hsa01230 Biosynthesis of amino acids 2
hsa00260 Glycine, serine and threonine metabolism 1
hsa00670 One carbon pool by folate 1
hsa00970 Aminoacyl-tRNA biosynthesis 1
  logo