RefMet Compound Details
MW structure | 38348 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Myo-inositol hexakisphosphate | |
Systematic name | {[2,3,4,5,6-pentakis(phosphonooxy)cyclohexyl]oxy}phosphonic acid | |
SMILES | [C@@H]1([C@@H]([C@H]([C@@H]([C@H]([C@H]1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 659.861388 (neutral) |
Table of KEGG reactions in human pathways involving Myo-inositol hexakisphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R05202 | Phytic acid + ADP <=> 1D-myo-Inositol 1,3,4,5,6-pentakisphosphate + ATP | ATP:1D-myo-inositol 1,3,4,5,6-pentakisphosphate 2-phosphotransferase |
R05799 | ATP + Phytic acid <=> ADP + 1-Diphosinositol pentakisphosphate | ATP:1D-myo-inositol-hexakisphosphate phosphotransferase |
R09087 | ATP + Phytic acid <=> ADP + 5-PP-InsP5 | ATP:1D-myo-inositol-hexakisphosphate 5-phosphotransferase |
Table of KEGG human pathways containing Myo-inositol hexakisphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa04070 | Phosphatidylinositol signaling system | 3 |
hsa00562 | Inositol phosphate metabolism | 1 |