RefMet Compound Details
MW structure | 39042 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | O-Phospho-4-hydroxy-threonine | |
Systematic name | (2S,3S)-2-amino-3-hydroxy-4-(phosphonooxy)butanoic acid | |
SMILES | C([C@H]([C@@H](C(=O)O)N)O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 215.019488 (neutral) |
Table of KEGG reactions in human pathways involving O-Phospho-4-hydroxy-threonine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R05085 | O-Phospho-4-hydroxy-L-threonine + 2-Oxoglutarate <=> 2-Oxo-3-hydroxy-4-phosphobutanoate + L-Glutamate | O-Phospho-4-hydroxy-L-threonine:2-oxoglutarate aminotransferase |
Table of KEGG human pathways containing O-Phospho-4-hydroxy-threonine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00750 | Vitamin B6 metabolism | 1 |