RefMet Compound Details
MW structure | 37146 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Orotic acid | |
Systematic name | 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid | |
SMILES | c1c(C(=O)O)[nH]c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 156.017108 (neutral) |
Table of KEGG reactions in human pathways involving Orotic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01867 | (S)-Dihydroorotate + Fumarate <=> Orotate + Succinate | (S)-dihydroorotate:fumarate oxidoreductase |
R01868 | (S)-Dihydroorotate + Quinone <=> Orotate + Hydroquinone | (S)-dihydroorotate:quinone oxidoreductase |
R01869 | (S)-Dihydroorotate + NAD+ <=> Orotate + H+ + NADH | (S)-dihydroorotate:NAD+ oxidoreductase |
Table of KEGG human pathways containing Orotic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |
hsa01240 | Biosynthesis of cofactors | 2 |