RefMet Compound Details
MW structure | 15059 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | PC O-16:1(11Z)/0:0 | |
SMILES | CCCC/C=C\CCCCCCCCCCOC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 493.3168 (neutral) |
Table of KEGG reactions in human pathways involving PC O-16:1(11Z)/0:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07387 | 1-Radyl-2-acyl-sn-glycero-3-phosphocholine + H2O <=> 1-Organyl-2-lyso-sn-glycero-3-phosphocholine + Carboxylate | plasmanylcholine 2-acylhydrolase |
R03438 | Acyl-CoA + 1-Organyl-2-lyso-sn-glycero-3-phosphocholine <=> CoA + 1-Radyl-2-acyl-sn-glycero-3-phosphocholine | Acyl-CoA:1-alkyl-sn-glycero-3-phosphocholine O-acyltransferase |
R07389 | 1-Alkyl-2-acylglycerol + CDP-choline <=> 1-Radyl-2-acyl-sn-glycero-3-phosphocholine + CMP | 1-Alkyl-2-acylglycerol + CDP-choline <=> 1-Radyl-2-acyl-sn-glycero-3-phosphocholine + CMP |
Table of KEGG human pathways containing PC O-16:1(11Z)/0:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00565 | Ether lipid metabolism | 3 |