RefMet Compound Details
MW structure | 2379 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | PGG2 | |
Systematic name | 9S,11R-epidioxy-15S-hydroperoxy-5Z,13E-prostadienoic acid | |
SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H]2C[C@H]1OO2)OO Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 368.219890 (neutral) |
Table of KEGG reactions in human pathways involving PGG2
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00073 | Prostaglandin H2 + Acceptor + H2O <=> Prostaglandin G2 + Reduced acceptor | reduced acceptor:prostaglandin G2 oxidoreductase |
R01590 | Arachidonate + 2 Oxygen <=> Prostaglandin G2 | Arachidonate:oxygen oxidoreductase |
Table of KEGG human pathways containing PGG2
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 2 |