RefMet Compound Details
MW structure | 50624 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Pantetheine | |
Systematic name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-{3-oxo-3-[(2-sulfanylethyl)amino]propyl}butanamide | |
SMILES | CC(C)(CO)[C@H](C(=O)NCCC(=O)NCCS)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 278.130030 (neutral) |
Table of KEGG reactions in human pathways involving Pantetheine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02973 | Pantetheine + H2O <=> Pantothenate + Cysteamine | (R)-pantetheine amidohydrolase |
R02971 | ATP + Pantetheine <=> ADP + Pantetheine 4'-phosphate | ATP:pantothenate 4'-phosphotransferase |
Table of KEGG human pathways containing Pantetheine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00770 | Pantothenate and CoA biosynthesis | 2 |