RefMet Compound Details

MW structure37108 (View MW Metabolite Database details)
RefMet namePhenylalanine
Systematic name(2S)-2-amino-3-phenylpropanoic acid
Canonical SMILESN[C@@H](Cc1ccccc1)C(O)=O
Exact mass165.0790View other entries in RefMet with this exact mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC9H11NO2View other entries in RefMet with this formula
InChIInChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1
InChIKeyCOLNVLDHVKWLRT-QMMMGPOBSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID6140

Table of KEGG reactions in human pathways involving Phenylalanine

Rxn IDKEGG ReactionEnzyme
R00699 L-Phenylalanine <=> Phenethylamine + CO2L-phenylalanine carboxy-lyase (phenylethylamine-forming)
R01795 Tetrahydrobiopterin + L-Phenylalanine + Oxygen <=> Dihydrobiopterin + L-Tyrosine + H2OL-Phenylalanine,tetrahydrobiopterin:oxygen oxidoreductase (4-hydroxylating)
R00688 L-Phenylalanine + H2O + NAD+ <=> Phenylpyruvate + Ammonia + NADH + H+L-phenylalanine:NAD+ oxidoreductase (deaminating)
R00694 L-Phenylalanine + 2-Oxoglutarate <=> Phenylpyruvate + L-GlutamateL-Phenylalanine:2-oxoglutarate aminotransferase
R00689 L-Phenylalanine + H2O + Oxygen <=> Phenylpyruvate + Ammonia + Hydrogen peroxideL-Phenylalanine:oxygen oxidoreductase (deaminating)
R00692 L-Phenylalanine + Pyruvate <=> Phenylpyruvate + L-AlanineL-phenylalanine:pyruvate aminotransferase

Table of KEGG human pathways containing Phenylalanine

Pathway IDHuman Pathway# of reactions
hsa00360 Phenylalanine metabolism 4
hsa00400 Phenylalanine, tyrosine and tryptophan biosynthesis 3
hsa01230 Biosynthesis of amino acids 1
  logo