RefMet Compound Details
MW structure | 37157 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Porphobilinogen | |
Systematic name | 3-[5-(aminomethyl)-4-(carboxymethyl)-1H-pyrrol-3-yl]propanoic acid | |
SMILES | C(CC(=O)O)c1c[nH]c(CN)c1CC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 226.095358 (neutral) |
Table of KEGG reactions in human pathways involving Porphobilinogen
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00036 | 2 5-Aminolevulinate <=> Porphobilinogen + 2 H2O | 5-aminolevulinate hydro-lyase (adding 5-aminolevulinate and cyclizing |
R00084 | 4 Porphobilinogen + H2O <=> Hydroxymethylbilane + 4 Ammonia | porphobilinogen:(4-[2-carboxyethyl]-3-[carboxymethyl]pyrrol-2-yl)methyltransferase (hydrolysing) |
Table of KEGG human pathways containing Porphobilinogen
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00860 | Porphyrin and chlorophyll metabolism | 2 |