RefMet Compound Details
MW structure | 37704 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Presqualene diphosphate | |
Systematic name | [({[(1S,2S,3S)-2-[(3E)-4,8-dimethylnona-3,7-dien-1-yl]-2-methyl-3-[(1E,5E)-2,6,10-trimethylundeca-1,5,9-trien-1-yl]cyclopropyl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid | |
SMILES | CC(=CCC/C(=C/CC/C(=C/[C@H]1[C@H](COP(=O)(O)OP(=O)(O)O)[C@@]1(C)CC/C=C(\C)/CCC=C(C)C)/C)/C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 586.318831 (neutral) |
Table of KEGG reactions in human pathways involving Presqualene diphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00702 | 2 trans,trans-Farnesyl diphosphate <=> Diphosphate + Presqualene diphosphate | farnesyl-diphosphate:farnesyl-diphosphate farnesyltransferase |
R02872 | Presqualene diphosphate + NADPH + H+ <=> Diphosphate + Squalene + NADP+ | presqualene-diphosphate diphosphate-lyase (reducing, squalene-forming) |
Table of KEGG human pathways containing Presqualene diphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 2 |