RefMet Compound Details

MW structure35438 (View MW Metabolite Database details)
RefMet nameProgesterone
Systematic namepregn-4-ene-3,20-dione
SMILESCC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Sum CompositionST 21:3;O2 View other entries in RefMet with this sum composition
Exact mass314.224580 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC21H30O2View other entries in RefMet with this formula
InChIInChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19
-,20-,21+/m0/s1
InChIKeyRJKFOVLPORLFTN-LEKSSAKUSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassSterol Lipids
Main ClassSteroids
Sub ClassC21 Steroids
Pubchem CID5994
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Progesterone

Rxn IDKEGG ReactionEnzyme
R02209 20alpha-Hydroxy-4-pregnen-3-one + NADP+ <=> Progesterone + NADPH + H+20alpha-Hydroxy-4-pregnen-3-one:NADP+ 20-oxidoreductase
R02207 20alpha-Hydroxy-4-pregnen-3-one + NAD+ <=> Progesterone + NADH + H+20alpha-Hydroxy-4-pregnen-3-one:NAD+ 20-oxidoreductase
R02215 5beta-Pregnane-3,20-dione + Acceptor <=> Progesterone + Reduced acceptor5beta-Pregnane-3,20-dione:(acceptor) delta4-oxidoreductase
R02213 Progesterone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 11-Deoxycorticosterone + [Oxidized NADPH---hemoprotein reductase] + H2Oprogesterone,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating)
R02208 5alpha-Pregnane-3,20-dione + NADP+ <=> Progesterone + NADPH + H+5alpha-pregnane-3,20-dione:NADP+ delta4-oxidoreductase
R02219 Progesterone + NADPH + H+ <=> 5beta-Pregnane-3,20-dione + NADP+3-Oxo-5beta-steroid:NADP+ delta4-oxidoreductase
R02211 Progesterone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 17alpha-Hydroxyprogesterone + [Oxidized NADPH---hemoprotein reductase] + H2Oprogesterone,NADPH-hemoprotein reductase:oxygen oxidoreductase (17alpha-hydroxylating)
R02218 Progesterone + 2 Reduced ferredoxin + Oxygen + 2 H+ <=> 11beta-Hydroxyprogesterone + 2 Oxidized ferredoxin + H2Oprogesterone,reduced ferredoxin:oxygen oxidoreductase (11-hydroxylating)
R02216 Pregnenolone + NAD+ <=> Progesterone + NADH + H+Pregnenolone:NAD+ 3-oxidoreductase

Table of KEGG human pathways containing Progesterone

Pathway IDHuman Pathway# of reactions
hsa00140 Steroid hormone biosynthesis 8
hsa01100 Metabolic pathways 3
  logo