RefMet Compound Details

MW structure37110 (View MW Metabolite Database details)
RefMet nameProline
Systematic name(2S)-pyrrolidine-2-carboxylic acid
Canonical SMILESOC(=O)[C@@H]1CCCN1
Exact mass115.0633View other entries in RefMet with this exact mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC5H9NO2View other entries in RefMet with this formula
InChIInChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1
InChIKeyONIBWKKTOPOVIA-BYPYZUCNSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID145742

Table of KEGG reactions in human pathways involving Proline

Rxn IDKEGG ReactionEnzyme
R00135 Peptide + H2O <=> L-Proline + PeptidePeptide + H2O <=> L-Proline + Peptide
R01248 L-Proline + NAD+ <=> (S)-1-Pyrroline-5-carboxylate + NADH + H+L-Proline:NAD+ 5-oxidoreductase
R01251 L-Proline + NADP+ <=> (S)-1-Pyrroline-5-carboxylate + NADPH + H+L-Proline:NADP+ 5-oxidoreductase
R01253 L-Proline + Quinone <=> (S)-1-Pyrroline-5-carboxylate + HydroquinoneL-proline:quinone oxidoreductase
R10507 L-Proline + FAD <=> (S)-1-Pyrroline-5-carboxylate + FADH2L-proline:(acceptor) oxidoreductase
R01252 L-Proline + 2-Oxoglutarate + Oxygen <=> Hydroxyproline + Succinate + CO2L-Proline,2-oxoglutarate:oxygen oxidoreductase (4-hydroxylating)

Table of KEGG human pathways containing Proline

Pathway IDHuman Pathway# of reactions
hsa00330 Arginine and proline metabolism 2
  logo