RefMet Compound Details

MW structure1584 (View MW Metabolite Database details)
RefMet namePyruvic acid
Systematic name2-oxo-propionic acid
SMILESCC(=O)C(O)=O
Sum CompositionPyruvic acid View other entries in RefMet with this sum composition
Exact mass88.016045 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC3H4O3View other entries in RefMet with this formula
InChIInChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)
InChIKeyLCTONWCANYUPML-UHFFFAOYSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassShort-chain acids
Sub ClassShort-chain acids
Pubchem CID1060
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Pyruvic acid

Rxn IDKEGG ReactionEnzyme
R00209 Pyruvate + CoA + NAD+ <=> Acetyl-CoA + CO2 + NADH + H+pyruvate:NAD+ 2-oxidoreductase (CoA-acetylating)
R00344 ATP + Pyruvate + HCO3- <=> ADP + Orthophosphate + OxaloacetatePyruvate:carbon-dioxide ligase (ADP-forming)
R12212 Oxaloacetate + 2 Sodium cation <=> Pyruvate + CO2 + 2 Sodium cationoxaloacetate carboxy-lyase (pyruvate-forming
R01447 (S)-Lactate + Oxaloacetate <=> (S)-Malate + Pyruvate(S)-Lactate:oxaloacetate oxidoreductase
R11591 (R)-Lactate + Quinone <=> Pyruvate + Hydroquinone(R)-lactate:quinone 2-oxidoreductase
R00200 ATP + Pyruvate <=> ADP + PhosphoenolpyruvateATP:pyruvate 2-O-phosphotransferase
R10866 Pyruvate + CoA + Oxidized flavodoxin <=> Acetyl-CoA + CO2 + Reduced flavodoxinpyruvate:flavodoxin 2-oxidoreductase (CoA-acetylating)
R00198 (R)-Lactate + 2 Ferricytochrome c-553 <=> Pyruvate + 2 Ferrocytochrome c-553 + 2 H+(R)-Lactate:ferricytochrome-c-553 2-oxidoreductase
R00206 ATP + Pyruvate + Orthophosphate <=> AMP + Phosphoenolpyruvate + DiphosphateATP:pyruvate,phosphate phosphotransferase
R02320 Nucleoside triphosphate + Pyruvate <=> NDP + PhosphoenolpyruvateNTP:pyruvate O2-phosphotransferase
R00217 Oxaloacetate <=> Pyruvate + CO2oxaloacetate carboxy-lyase (pyruvate-forming)
R00196 (S)-Lactate + 2 Ferricytochrome c <=> Pyruvate + 2 Ferrocytochrome c + 2 H+(S)-Lactate:ferricytochrome-c 2-oxidoreductase
R01196 2 Reduced ferredoxin + Acetyl-CoA + CO2 + 2 H+ <=> 2 Oxidized ferredoxin + Pyruvate + CoApyruvate:ferredoxin 2-oxidoreductase (CoA-acetylating)
R00199 ATP + Pyruvate + H2O <=> AMP + Phosphoenolpyruvate + OrthophosphateATP:pyruvate,water phosphotransferase
R00400 L-Alanine + Oxaloacetate <=> Pyruvate + L-AspartateL-alanine:oxaloacetate aminotransferase
R00782 L-Cysteine + H2O <=> Hydrogen sulfide + Pyruvate + AmmoniaL-cysteine hydrogen-sulfide-lyase (deaminating
R00369 L-Alanine + Glyoxylate <=> Pyruvate + GlycineL-Alanine:glyoxylate aminotransferase
R00258 L-Alanine + 2-Oxoglutarate <=> Pyruvate + L-GlutamateL-Alanine:2-oxoglutarate aminotransferase
R00703 (S)-Lactate + NAD+ <=> Pyruvate + NADH + H+(S)-Lactate:NAD+ oxidoreductase
R00197 (R)-Lactate + 2 Ferricytochrome c <=> Pyruvate + 2 Ferrocytochrome c + 2 H+(R)-Lactate:ferricytochrome-c 2-oxidoreductase
R00704 (R)-Lactate + NAD+ <=> Pyruvate + NADH + H+(R)-Lactate:NAD+ oxidoreductase
R00396 L-Alanine + NAD+ + H2O <=> Pyruvate + Ammonia + NADH + H+L-alanine:NAD+ oxidoreductase (deaminating)
R00212 Acetyl-CoA + Formate <=> CoA + PyruvateAcetyl-CoA:formate C-acetyltransferase
R00220 L-Serine <=> Pyruvate + AmmoniaL-serine ammonia-lyase
R03105 Mercaptopyruvate + Thioredoxin <=> Hydrogen sulfide + Pyruvate + Thioredoxin disulfide3-mercaptopyruvate:sulfide sulfurtransferase
R11593 Pyruvate + (R)-2-Hydroxyglutarate <=> (R)-Lactate + 2-Oxoglutarate(R)-2-hydroxyglutarate:pyruvate oxidoreductase [(R)-lactate-forming]

Table of KEGG human pathways containing Pyruvic acid

Pathway IDHuman Pathway# of reactions
hsa00620 Pyruvate metabolism 5
hsa01200 Carbon metabolism 5
hsa01230 Biosynthesis of amino acids 4
hsa00010 Glycolysis / Gluconeogenesis 2
hsa00250 Alanine, aspartate and glutamate metabolism 2
hsa00270 Cysteine and methionine metabolism 2
hsa00020 Citrate cycle (TCA cycle) 1
hsa00350 Tyrosine metabolism 1
hsa00230 Purine metabolism 1
hsa00220 Arginine biosynthesis 1
hsa00260 Glycine, serine and threonine metabolism 1
  logo