RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet ID	RM0134967
RefMet name	Pyruvic acid
Systematic name	2-oxo-propionic acid
Synonyms	PubChem Synonyms
Exact mass	88.016045 (neutral)	Calculate m/z: (Choose adduct) [M+H]+ [M+H-H2O]+ [M.]+ [M+2H]2+ [M+3H]3+ [M+4H]4+ [M+K]+ [M+2K]2+ [M+2K-H]+ [M+Na]+ [M+2Na]2+ [M+2Na-H]+ [M+Li]+ [M+2Li]2+ [M+NH4]+ [M.CH3]+ [M+Ag]+ [M+H+CH3OH]+ [M+H+CH3CN]+ [M+H+2CH3CN]+ [M+Na+CH3CN]+ [M.NaFormate+H]+ [M.NH4Formate+H]+ [M.TMSi]+ [M.tBuDMSi]+ [M+H-Hexose]+ [M+H-EtnP]+ [M+H-SerP]+ [M-H]- [M-H-H2O]- [M-CH3]- [M-2H]2- [M-3H]3- [M-4H]4- [M+Cl]- [M+OAc]- [M+Na-2H]- [M+K-2H]- [M.Formate]- [M.NaFormate-H]- [M.NH4Formate-H]- [M.F]- [M-H-Ser]- [M.HF2]- M(neutral)    View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
Formula	C3H4O3	View other entries in RefMet with this formula
Molecular descriptors
Molfile	1584 (Download molfile/View MW Metabolite Database details)
InChI	InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)
InChIKey	LCTONWCANYUPML-UHFFFAOYSA-N	View other enantiomers/diastereomers of this metabolite in RefMet
SMILES	CC(=O)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super Class	Organic acids
Main Class	Short-chain acids
Sub Class	Short-chain acids
Distribution of Pyruvic acid in NMDR studies
Species	Plot Species distribution
Sample source	Plot Sample source(tissue) distribution
Platform	Platform (MS/NMR) used for detection
Chromatography	Chromatography methods used for detection
Studies	NMDR Studies reporting Pyruvic acid
External Links
Pubchem CID	1060
LIPID MAPS	LMFA01060077
ChEBI ID	32816
KEGG ID	C00022
HMDB ID	HMDB0000243
Chemspider ID	1031
MetaCyc ID	PYRUVATE
EPA CompTox	DTXCID801650
Spectral data for Pyruvic acid standards
BMRB ID(NMR)	View NMR spectra
NP-MRD ID(NMR)	View NMR spectra
MassBank(EU)	View MS spectra
Structural annotation level
Annotation level	1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Pyruvic acid

Rxn ID	KEGG Reaction	Enzyme
R00196	(S)-Lactate + 2 Ferricytochrome c <=> Pyruvate + 2 Ferrocytochrome c + 2 H+	(S)-Lactate:ferricytochrome-c 2-oxidoreductase
R00197	(R)-Lactate + 2 Ferricytochrome c <=> Pyruvate + 2 Ferrocytochrome c + 2 H+	(R)-Lactate:ferricytochrome-c 2-oxidoreductase
R00198	(R)-Lactate + 2 Ferricytochrome c-553 <=> Pyruvate + 2 Ferrocytochrome c-553 + 2 H+	(R)-Lactate:ferricytochrome-c-553 2-oxidoreductase
R00199	ATP + Pyruvate + H2O <=> AMP + Phosphoenolpyruvate + Orthophosphate	ATP:pyruvate,water phosphotransferase
R00200	ATP + Pyruvate <=> ADP + Phosphoenolpyruvate	ATP:pyruvate 2-O-phosphotransferase
R00206	ATP + Pyruvate + Orthophosphate <=> AMP + Phosphoenolpyruvate + Diphosphate	ATP:pyruvate,phosphate phosphotransferase
R00209	Pyruvate + CoA + NAD+ <=> Acetyl-CoA + CO2 + NADH + H+	pyruvate:NAD+ 2-oxidoreductase (CoA-acetylating)
R00212	Acetyl-CoA + Formate <=> CoA + Pyruvate	Acetyl-CoA:formate C-acetyltransferase
R00214	(S)-Malate + NAD+ <=> Pyruvate + CO2 + NADH + H+	(S)-malate:NAD+ oxidoreductase (decarboxylating)
R00216	(S)-Malate + NADP+ <=> Pyruvate + CO2 + NADPH + H+	(S)-Malate:NADP+ oxidoreductase(oxaloacetate-decarboxylating)
R00217	Oxaloacetate <=> Pyruvate + CO2	oxaloacetate carboxy-lyase (pyruvate-forming)
R00220	L-Serine <=> Pyruvate + Ammonia	L-serine ammonia-lyase
R00258	L-Alanine + 2-Oxoglutarate <=> Pyruvate + L-Glutamate	L-Alanine:2-oxoglutarate aminotransferase
R00297	(R)-Lactate + Acceptor <=> Pyruvate + Reduced acceptor	(R)-2-hydroxy-acid:acceptor 2-oxidoreductase
R00344	ATP + Pyruvate + HCO3- <=> ADP + Orthophosphate + Oxaloacetate	Pyruvate:carbon-dioxide ligase (ADP-forming)
R00369	L-Alanine + Glyoxylate <=> Pyruvate + Glycine	L-Alanine:glyoxylate aminotransferase
R00396	L-Alanine + NAD+ + H2O <=> Pyruvate + Ammonia + NADH + H+	L-alanine:NAD+ oxidoreductase (deaminating)
R00400	L-Alanine + Oxaloacetate <=> Pyruvate + L-Aspartate	L-alanine:oxaloacetate aminotransferase
R00703	(S)-Lactate + NAD+ <=> Pyruvate + NADH + H+	(S)-Lactate:NAD+ oxidoreductase
R00704	(R)-Lactate + NAD+ <=> Pyruvate + NADH + H+	(R)-Lactate:NAD+ oxidoreductase
R00782	L-Cysteine + H2O <=> Hydrogen sulfide + Pyruvate + Ammonia	L-cysteine hydrogen-sulfide-lyase (deaminating
R01196	2 Reduced ferredoxin + Acetyl-CoA + CO2 + 2 H+ <=> 2 Oxidized ferredoxin + Pyruvate + CoA	pyruvate:ferredoxin 2-oxidoreductase (CoA-acetylating)
R01447	(S)-Lactate + Oxaloacetate <=> (S)-Malate + Pyruvate	(S)-Lactate:oxaloacetate oxidoreductase
R02320	Nucleoside triphosphate + Pyruvate <=> NDP + Phosphoenolpyruvate	NTP:pyruvate O2-phosphotransferase
R03105	Mercaptopyruvate + Thioredoxin <=> Hydrogen sulfide + Pyruvate + Thioredoxin disulfide	3-mercaptopyruvate:sulfide sulfurtransferase
R10866	Pyruvate + CoA + Oxidized flavodoxin <=> Acetyl-CoA + CO2 + Reduced flavodoxin	pyruvate:flavodoxin 2-oxidoreductase (CoA-acetylating)
R11591	(R)-Lactate + Quinone <=> Pyruvate + Hydroquinone	(R)-lactate:quinone 2-oxidoreductase
R11593	Pyruvate + (R)-2-Hydroxyglutarate <=> (R)-Lactate + 2-Oxoglutarate	(R)-2-hydroxyglutarate:pyruvate oxidoreductase [(R)-lactate-forming]
R12212	Oxaloacetate + 2 Sodium cation <=> Pyruvate + CO2 + 2 Sodium cation	oxaloacetate carboxy-lyase (pyruvate-forming
R13049	(R)-Lactate + 2 NAD+ + 2 Reduced ferredoxin <=> Pyruvate + 2 NADH + 2 Oxidized ferredoxin	(R)-lactate:NAD+,ferredoxin oxidoreductase
R13050	(S)-Lactate + 2 NAD+ + 2 Reduced ferredoxin <=> Pyruvate + 2 NADH + 2 Oxidized ferredoxin	(S)-lactate:NAD+,ferredoxin oxidoreductase

Table of KEGG human pathways containing Pyruvic acid

Pathway ID	Human Pathway	# of reactions
hsa01100	Metabolic pathways	19
hsa00620	Pyruvate metabolism	7
hsa01200	Carbon metabolism	5
hsa01230	Biosynthesis of amino acids	4
hsa00010	Glycolysis / Gluconeogenesis	3
hsa00250	Alanine, aspartate and glutamate metabolism	2
hsa00270	Cysteine and methionine metabolism	2
hsa00020	Citrate cycle (TCA cycle)	2
hsa00260	Glycine, serine and threonine metabolism	1
hsa00230	Purine metabolism	1
hsa00220	Arginine biosynthesis	1
hsa00350	Tyrosine metabolism	1