RefMet Compound Details
RefMet ID | RM0135919 | |
---|---|---|
MW structure | 37156 (View MW Metabolite Database details) | |
RefMet name | Riboflavin Species distribution Sample source distribution | |
Systematic name | 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2H,3H,4H,10H-benzo[g]pteridine-2,4-dione | |
SMILES | Cc1cc2c(cc1C)n(C[C@@H]([C@@H]([C@@H](CO)O)O)O)c1c(c(=O)[nH]c(=O)n1)n2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 376.138286 (neutral) |
Table of KEGG reactions in human pathways involving Riboflavin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00548 | FMN + H2O <=> Riboflavin + Orthophosphate | riboflavin-5-phosphate phosphohydrolase |
R00549 | ATP + Riboflavin <=> ADP + FMN | ATP:riboflavin 5'-phosphotransferase |
R00550 | D-Glucose 1-phosphate + Riboflavin <=> D-Glucose + FMN | D-Glucose-1-phosphate:riboflavin 5'-phosphotransferase |
R05707 | Reduced riboflavin + NADP+ <=> Riboflavin + NADPH + H+ | reduced-riboflavin:NADP+ oxidoreductase |
R08574 | CTP + Riboflavin <=> CDP + FMN | CTP:riboflavin 5'-phosphotransferase |
R09750 | Reduced riboflavin + NAD+ <=> Riboflavin + NADH + H+ | reduced-riboflavin:NAD+ oxidoreductase |
Table of KEGG human pathways containing Riboflavin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00740 | Riboflavin metabolism | 3 |
hsa01100 | Metabolic pathways | 3 |