RefMet Compound Details
MW structure | 49956 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | S-(Formylmethyl)glutathione | |
Systematic name | (2S)-2-azanyl-5-[[(2R)-1-(2-hydroxy-2-oxoethylamino)-1-oxidanylidene-3-(2-oxidanylideneethylsulfanyl)propan-2-yl]amino]-5-oxidanylidene-pentanoic acid | |
SMILES | C(CC(=O)N[C@@H](CSCC=O)C(=O)NCC(=O)O)[C@@H](C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 349.094374 (neutral) |
Table of KEGG reactions in human pathways involving S-(Formylmethyl)glutathione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07116 | 2-Bromoacetaldehyde + Glutathione <=> S-(Formylmethyl)glutathione + Hydrobromic acid | 2-bromoacetaldehyde:glutathione S-(formylmethyl)transferase |
Table of KEGG human pathways containing S-(Formylmethyl)glutathione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00980 | Metabolism of xenobiotics by cytochrome P450 | 1 |