RefMet Compound Details
MW structure | 69664 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | SN-38G | |
Systematic name | (2S)-2-[2-[(2S,3R,4S,5S,6S)-6-carboxy-3,4,5-trihydroxy-tetrahydropyran-2-yl]oxy-12-ethyl-8-(hydroxymethyl)-9-oxo-11H-indolizino[1,2-b]quinolin-7-yl]-2-hydroxy-butanoate | |
SMILES | CCc1c2cc(ccc2nc2c1Cn1c2cc2c(COC(=O)[C@@]2(CC)O)c1=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 568.169313 (neutral) |
Table of KEGG reactions in human pathways involving SN-38G
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08259 | SN-38 + UDP-glucuronate <=> SN38 glucuronide + UDP | SN-38 + UDP-glucuronate <=> SN38 glucuronide + UDP |
R08260 | SN38 glucuronide + H2O <=> SN-38 + D-Glucuronate | SN38 glucuronide glucuronosohydrolase |
Table of KEGG human pathways containing SN-38G
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00983 | Drug metabolism - other enzymes | 2 |