RefMet Compound Details

MW structure	37173 (View MW Metabolite Database details)
RefMet name	Sarcosine
Systematic name	2-(methylamino)acetic acid
SMILES	CNCC(=O)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass	89.047679 (neutral)	Calculate m/z: (Choose adduct) [M+H]+ [M+H-H2O]+ [M.]+ [M+2H]2+ [M+3H]3+ [M+4H]4+ [M+K]+ [M+2K]2+ [M+2K-H]+ [M+Na]+ [M+2Na]2+ [M+2Na-H]+ [M+Li]+ [M+2Li]2+ [M+NH4]+ [M.CH3]+ [M+Ag]+ [M+H+CH3OH]+ [M+H+CH3CN]+ [M+H+2CH3CN]+ [M+Na+CH3CN]+ [M.NaFormate+H]+ [M.NH4Formate+H]+ [M.TMSi]+ [M.tBuDMSi]+ [M+H-Hexose]+ [M+H-EtnP]+ [M+H-SerP]+ [M-H]- [M-H-H2O]- [M-CH3]- [M-2H]2- [M-3H]3- [M-4H]4- [M+Cl]- [M+OAc]- [M+Na-2H]- [M+K-2H]- [M.Formate]- [M.NaFormate-H]- [M.NH4Formate-H]- [M.F]- [M-H-Ser]- [M.HF2]- M(neutral)    View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
Formula	C3H7NO2	View other entries in RefMet with this formula
InChI	InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6)
InChIKey	FSYKKLYZXJSNPZ-UHFFFAOYSA-N	View other enantiomers/diastereomers of this metabolite in RefMet
Super Class	Organic acids
Main Class	Amino acids and peptides
Sub Class	Amino acids
Pubchem CID	1088
Annotation level	1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Sarcosine

Rxn ID	KEGG Reaction	Enzyme
R01564	N,N-Dimethylglycine + H2O + Oxygen <=> Sarcosine + Formaldehyde + Hydrogen peroxide	N,N-Dimethylglycine:oxygen oxidoreductase (demethylating)
R00611	Sarcosine + Electron-transferring flavoprotein + H2O <=> Glycine + Formaldehyde + Reduced electron-transferring flavoprotein	sarcosine:electron-transfer flavoprotein oxidoreductase (demethylating)
R13028	N,N-Dimethylglycine + 2 Oxidized ferredoxin + H2O <=> Sarcosine + Formaldehyde + 2 Reduced ferredoxin + 2 H+	N,N-dimethylglycine:ferredoxin oxidoreductase (demethylating)
R00610	Sarcosine + H2O + Oxygen <=> Glycine + Formaldehyde + Hydrogen peroxide	sarcosine:oxygen oxidoreductase (demethylating)
R13029	Sarcosine + 2 Oxidized ferredoxin + H2O <=> Glycine + Formaldehyde + 2 Reduced ferredoxin + 2 H+	sarcosine:ferredoxin oxidoreductase (demethylating)
R00367	S-Adenosyl-L-methionine + Glycine <=> S-Adenosyl-L-homocysteine + Sarcosine	S-Adenosyl-L-methionine:glycine N-methyltransferase
R12967	Sarcosine + Tetrahydrofolate + Oxygen <=> Glycine + 5,10-Methylenetetrahydrofolate + Hydrogen peroxide	sarcosine, 5,6,7,8-tetrahydrofolate:O2 oxidoreductase (demethylating,5,10-methylenetetrahydrofolate-forming)
R01565	N,N-Dimethylglycine + Tetrahydrofolate + Electron-transferring flavoprotein <=> Sarcosine + 5,10-Methylenetetrahydrofolate + Reduced electron-transferring flavoprotein	N,N-dimethylglycine,5,6,7,8-tetrahydrofolate:electron-transferflavoprotein oxidoreductase (demethylating,5,10-methylenetetrahydrofolate-forming)

Table of KEGG human pathways containing Sarcosine

Pathway ID	Human Pathway	# of reactions
hsa00260	Glycine, serine and threonine metabolism	4
hsa01100	Metabolic pathways	4