RefMet Compound Details
MW structure | 28710 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Squalene | |
Systematic name | Squalene | |
SMILES | CC(=CCC/C(=C/CC/C(=C/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)/C)/C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 410.391250 (neutral) |
Table of KEGG reactions in human pathways involving Squalene
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R12355 | Squalene + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> (S)-2,3-Epoxysqualene + 2 Ferricytochrome b5 + H2O | Squalene + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> (S)-2,3-Epoxysqualene + 2 Ferricytochrome b5 + H2O |
R02872 | Presqualene diphosphate + NADPH + H+ <=> Diphosphate + Squalene + NADP+ | presqualene-diphosphate diphosphate-lyase (reducing, squalene-forming) |
R02874 | Squalene + Oxygen + [Reduced NADPH---hemoprotein reductase] <=> (S)-2,3-Epoxysqualene + [Oxidized NADPH---hemoprotein reductase] + H2O | squalene,NADPH-hemoprotein:oxygen oxidoreductase (2,3-epoxidizing) |
R06223 | 2 trans,trans-Farnesyl diphosphate + NADPH + H+ <=> Squalene + 2 Diphosphate + NADP+ | squalene synthase |
Table of KEGG human pathways containing Squalene
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 2 |
hsa01100 | Metabolic pathways | 2 |