RefMet Compound Details
MW structure | 35313 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Testosterone | |
Systematic name | 17beta-hydroxyandrost-4-en-3-one | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@@H]([C@@]3(C)CC[C@H]21)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 19:2;O2 | View other entries in RefMet with this sum composition |
Exact mass | 288.208930 (neutral) |
Table of KEGG reactions in human pathways involving Testosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01838 | Testosterone + NADP+ <=> Androstenedione + NADPH + H+ | testosterone:NADP+ 17-oxidoreductase |
R02502 | Testosterone + UDP-glucuronate <=> Testosterone glucuronide + UDP | 17beta-hydroxysteroid UDP-glucuronosyltransferase |
R02499 | Testosterone + H+ + NADH <=> Androstenediol + NAD+ | Testosterone delta5-delat4-isomerase |
R02498 | 5beta-Dihydrotestosterone + NADP+ <=> Testosterone + NADPH + H+ | 5beta-dihydrotestosterone:NADP+ 4,5-oxidoreductase |
R01836 | Testosterone + NAD+ <=> Androstenedione + NADH + H+ | testosterone:NAD+ 17-oxidoreductase |
R02501 | Testosterone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 19-Hydroxytestosterone + [Oxidized NADPH---hemoprotein reductase] + H2O | testosterone,NADPH---hemoprotein reductase:oxygen oxidoreductase (19-hydroxylating) |
R02497 | Dihydrotestosterone + NADP+ <=> Testosterone + NADPH + H+ | dihydrotestosterone:NADP+ delta4-oxidoreductase |
Table of KEGG human pathways containing Testosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 7 |