RefMet Compound Details
MW structure | 36910 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Testosterone glucuronide | |
Systematic name | 17beta-hydroxyandrost-4-en-3-one 3-D-glucuronide | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]3CC[C@@H]([C@@]3(C)CC[C@H]21)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 19:2;O2;GlcA | View other entries in RefMet with this sum composition |
Exact mass | 464.241020 (neutral) |
Table of KEGG reactions in human pathways involving Testosterone glucuronide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02502 | Testosterone + UDP-glucuronate <=> Testosterone glucuronide + UDP | 17beta-hydroxysteroid UDP-glucuronosyltransferase |
Table of KEGG human pathways containing Testosterone glucuronide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 1 |