RefMet Compound Details
MW structure | 38208 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Theobromine | |
Systematic name | 3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione | |
SMILES | Cn1cnc2c1c(=O)[nH]c(=O)n2C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 180.064726 (neutral) |
Table of KEGG reactions in human pathways involving Theobromine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07978 | Theobromine + H2O + Oxygen <=> 3,7-Dimethyluric acid + Hydrogen peroxide | 3,7-dimethylxanthine:oxygen oxidoreductase |
Table of KEGG human pathways containing Theobromine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00232 | Caffeine metabolism | 1 |