RefMet Compound Details
MW structure | 37175 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Thymidine | |
Systematic name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione | |
SMILES | Cc1cn([C@H]2C[C@@H]([C@@H](CO)O2)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 242.090273 (neutral) |
Table of KEGG reactions in human pathways involving Thymidine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01570 | Thymidine + Orthophosphate <=> Thymine + 2-Deoxy-D-ribose 1-phosphate | thymidine:phosphate deoxy-alpha-D-ribosyltransferase |
R01569 | dTMP + H2O <=> Thymidine + Orthophosphate | thymidylate 5'-phosphohydrolase |
R02806 | Thymidine + Base <=> Deoxynucleoside + Thymine | Nucleoside:purine(pyrimidine) deoxy-D-ribosyltransferase |
R01567 | ATP + Thymidine <=> ADP + dTMP | ATP:thymidine 5'-phosphotransferase |
Table of KEGG human pathways containing Thymidine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 3 |