RefMet Compound Details

MW structure37505 (View MW Metabolite Database details)
RefMet nameTryptophan
Systematic name(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid
Canonical SMILESN[C@@H](Cc1c[nH]c2ccccc21)C(O)=O
Exact mass204.0899View other entries in RefMet with this exact mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC11H12N2O2View other entries in RefMet with this formula
InChIInChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1
InChIKeyQIVBCDIJIAJPQS-VIFPVBQESA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub classAmino acids
Pubchem CID6305

Table of KEGG reactions in human pathways involving Tryptophan

Rxn IDKEGG ReactionEnzyme
R00677 L-Tryptophan + H2O + Oxygen <=> Indolepyruvate + Ammonia + Hydrogen peroxideL-Tryptophan:oxygen oxidoreductase (deaminating)
R00678 L-Tryptophan + Oxygen <=> L-FormylkynurenineL-tryptophan:oxygen 2,3-oxidoreductase (decyclizing)
R01814 Tetrahydrobiopterin + L-Tryptophan + Oxygen <=> 5-Hydroxy-L-tryptophan + Dihydrobiopterin + H2OL-Tryptophan,tetrahydrobiopterin:oxygen oxidoreductase (5-hydroxylating)
R00684 L-Tryptophan + 2-Oxoglutarate <=> Indolepyruvate + L-GlutamateL-Tryptophan:2-oxoglutarate aminotransferase
R00685 L-Tryptophan <=> Tryptamine + CO2L-tryptophan decarboxy-lyase
R10180 L-Tryptophan + Pyruvate <=> Indolepyruvate + L-AlanineL-tryptophan:pyruvate aminotransferase
R12055 L-Methionine + Indolepyruvate <=> 4-Methylthio-2-oxobutanoic acid + L-TryptophanL-methionine:indole-3-pyruvic acid aminotransferase

Table of KEGG human pathways containing Tryptophan

Pathway IDHuman Pathway# of reactions
hsa00380 Tryptophan metabolism 4
  logo