RefMet Compound Details
MW structure | 37107 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Tyrosine | |
Systematic name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid | |
SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 181.073894 (neutral) |
Table of KEGG reactions in human pathways involving Tyrosine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01815 | Tetrahydrobiopterin + L-Tyrosine + Oxygen <=> 3,4-Dihydroxy-L-phenylalanine + Dihydrobiopterin + H2O | L-Tyrosine,tetrahydrobiopterin:oxygen oxidoreductase (3-hydroxylating) |
R00731 | L-Tyrosine + Oxygen <=> 3,4-Dihydroxy-L-phenylalanine + H2O | L-Tyrosine:oxygen oxidoreductase |
R00736 | L-Tyrosine <=> Tyramine + CO2 | L-tyrosine carboxy-lyase (tyramine-forming) |
R09830 | L-Tyrosine + H2O + NAD+ <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + NADH + H+ | L-Tyrosine:NAD+ oxidoreductase (deaminating) |
R01795 | Tetrahydrobiopterin + L-Phenylalanine + Oxygen <=> Dihydrobiopterin + L-Tyrosine + H2O | L-Phenylalanine,tetrahydrobiopterin:oxygen oxidoreductase (4-hydroxylating) |
R00031 | Oxygen + 2 L-Tyrosine <=> 2 3,4-Dihydroxy-L-phenylalanine | 1,2-benzenediol:oxygen oxidoreductase |
R00734 | L-Tyrosine + 2-Oxoglutarate <=> 3-(4-Hydroxyphenyl)pyruvate + L-Glutamate | L-tyrosine:2-oxoglutarate aminotransferase |
R09254 | L-Tyrosine + Pyruvate <=> 3-(4-Hydroxyphenyl)pyruvate + L-Alanine | L-tyrosine:pyruvate aminotransferase |
R12611 | L-Tyrosine + Hydrogen peroxide <=> 3,4-Dihydroxy-L-phenylalanine + H2O | L-tyrosine:hydrogen-peroxide oxidoreductase (L-dopa-forming) |
R02078 | 3,4-Dihydroxy-L-phenylalanine + L-Tyrosine + Oxygen <=> Dopaquinone + 3,4-Dihydroxy-L-phenylalanine + H2O | L-Tyrosine,L-dopa:oxygen oxidoreductase |
R00729 | L-Tyrosine + H2O + Oxygen <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + Hydrogen peroxide | L-Tyrosine:oxygen oxidoreductase (deaminating) |
R03539 | Hydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-Tyrosine | Hydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-Tyrosine |
R02918 | ATP + L-Tyrosine + tRNA(Tyr) <=> AMP + Diphosphate + L-Tyrosyl-tRNA(Tyr) | L-Tyrosine:tRNA(Tyr) ligase (AMP-forming) |
Table of KEGG human pathways containing Tyrosine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00350 | Tyrosine metabolism | 7 |
hsa01100 | Metabolic pathways | 4 |
hsa00400 | Phenylalanine, tyrosine and tryptophan biosynthesis | 3 |
hsa01230 | Biosynthesis of amino acids | 2 |
hsa00130 | Ubiquinone and other terpenoid-quinone biosynthesis | 1 |
hsa00970 | Aminoacyl-tRNA biosynthesis | 1 |
hsa00360 | Phenylalanine metabolism | 1 |