RefMet Compound Details

MW structure37107 (View MW Metabolite Database details)
RefMet nameTyrosine
Systematic name(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid
Canonical SMILESN[C@@H](Cc1ccc(O)cc1)C(O)=O
Exact mass181.0739View other entries in RefMet with this exact mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC9H11NO3View other entries in RefMet with this formula
InChIInChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1
InChIKeyOUYCCCASQSFEME-QMMMGPOBSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub classAmino acids
Pubchem CID6057

Table of KEGG reactions in human pathways involving Tyrosine

Rxn IDKEGG ReactionEnzyme
R01815 Tetrahydrobiopterin + L-Tyrosine + Oxygen <=> 3,4-Dihydroxy-L-phenylalanine + Dihydrobiopterin + H2OL-Tyrosine,tetrahydrobiopterin:oxygen oxidoreductase (3-hydroxylating)
R00731 L-Tyrosine + Oxygen <=> 3,4-Dihydroxy-L-phenylalanine + H2OL-Tyrosine:oxygen oxidoreductase
R00736 L-Tyrosine <=> Tyramine + CO2L-tyrosine carboxy-lyase (tyramine-forming)
R09830 L-Tyrosine + H2O + NAD+ <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + NADH + H+L-Tyrosine:NAD+ oxidoreductase (deaminating)
R01795 Tetrahydrobiopterin + L-Phenylalanine + Oxygen <=> Dihydrobiopterin + L-Tyrosine + H2OL-Phenylalanine,tetrahydrobiopterin:oxygen oxidoreductase (4-hydroxylating)
R00031 Oxygen + 2 L-Tyrosine <=> 2 3,4-Dihydroxy-L-phenylalanine1,2-benzenediol:oxygen oxidoreductase
R00734 L-Tyrosine + 2-Oxoglutarate <=> 3-(4-Hydroxyphenyl)pyruvate + L-GlutamateL-tyrosine:2-oxoglutarate aminotransferase
R09254 L-Tyrosine + Pyruvate <=> 3-(4-Hydroxyphenyl)pyruvate + L-AlanineL-tyrosine:pyruvate aminotransferase
R00729 L-Tyrosine + H2O + Oxygen <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + Hydrogen peroxideL-Tyrosine:oxygen oxidoreductase (deaminating)
R03539 Hydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-TyrosineHydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-Tyrosine

Table of KEGG human pathways containing Tyrosine

Pathway IDHuman Pathway# of reactions
hsa00350 Tyrosine metabolism 7
hsa00400 Phenylalanine, tyrosine and tryptophan biosynthesis 3
hsa01230 Biosynthesis of amino acids 2
hsa00130 Ubiquinone and other terpenoid-quinone biosynthesis 1
hsa00360 Phenylalanine metabolism 1
  logo