RefMet Compound Details
MW structure | 71723 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | UDP-N-acetylglucosamine | |
Systematic name | {[(2R,3S,4R,5R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}[({[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}(hydroxy)phosphoryl)oxy]phosphinic acid | |
SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H](C(n2ccc(=O)[nH]c2=O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 607.081578 (neutral) |
Table of KEGG reactions in human pathways involving UDP-N-acetylglucosamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00418 | UDP-N-acetyl-alpha-D-glucosamine <=> UDP-N-acetyl-D-galactosamine | UDP-N-acetyl-D-glucosamine 4-epimerase |
R00414 | UDP-N-acetyl-alpha-D-glucosamine + H2O <=> N-Acetyl-D-mannosamine + UDP | UDP-N-acetyl-D-glucosamine 2-epimerase |
R00416 | UTP + N-Acetyl-alpha-D-glucosamine 1-phosphate <=> Diphosphate + UDP-N-acetyl-alpha-D-glucosamine | UTP:N-acetyl-alpha-D-glucosamine-1-phosphate uridylyltransferase |
Table of KEGG human pathways containing UDP-N-acetylglucosamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 2 |
hsa01250 | Biosynthesis of nucleotide sugars | 1 |