RefMet Compound Details
MW structure | 51227 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | UDP-galactose | |
Systematic name | uridine 5'-[3-(D-galactopyranosyl) dihydrogen diphosphate] | |
SMILES | c1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)OP(=O)(O)OC3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O)O)O)O2)O)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 566.055029 (neutral) |
Table of KEGG reactions in human pathways involving UDP-galactose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00291 | UDP-glucose <=> UDP-alpha-D-galactose | UDP-glucose 4-epimerase |
R00955 | UDP-glucose + alpha-D-Galactose 1-phosphate <=> D-Glucose 1-phosphate + UDP-alpha-D-galactose | UDP-glucose:alpha-D-galactose-1-phosphate uridylyltransferase |
R00503 | UDP-alpha-D-galactose + D-Glucose <=> UDP + Lactose | UDP-alpha-D-galactose:D-glucose 4-beta-D-galactosyltransferase |
Table of KEGG human pathways containing UDP-galactose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00052 | Galactose metabolism | 3 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 2 |