RefMet Compound Details

MW structure37190 (View MW Metabolite Database details)
RefMet nameUridine
Systematic name1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,3,4-tetrahydropyrimidine-2,4-dione
Canonical SMILESOC[C@@H]1O[C@@H]([C@@H](O)[C@H]1O)N1C=CC(=O)NC1=O
Exact mass244.0695View other entries in RefMet with this exact mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC9H12N2O6View other entries in RefMet with this formula
InChIInChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1
InChIKeyDRTQHJPVMGBUCF-XVFCMESISA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassNucleic acids
Main ClassPyrimidines
Sub classPyrimidine ribonucleosides
Pubchem CID6029

Table of KEGG reactions in human pathways involving Uridine

Rxn IDKEGG ReactionEnzyme
R01878 Cytidine + H2O <=> Uridine + AmmoniaCytidine aminohydrolase
R00967 UTP + Uridine <=> UDP + UMPUTP:uridine 5'-phosphotransferase
R01549 dATP + Uridine <=> dADP + UMPdATP:uridine 5'-phosphotransferase
R02332 dUTP + Uridine <=> dUDP + UMPdUTP:uridine 5'-phosphotransferase
R01880 dGTP + Uridine <=> dGDP + UMPdGTP:uridine 5'-phosphotransferase
R02097 dTTP + Uridine <=> dTDP + UMPdTTP:uridine 5'-phosphotransferase
R02327 dCTP + Uridine <=> dCDP + UMPdCTP:uridine 5'-phosphotransferase
R00964 ATP + Uridine <=> ADP + UMPATP:uridine 5'-phosphotransferase
R01080 Uridine + H2O <=> Uracil + D-RiboseUridine ribohydrolase
R00963 UMP + H2O <=> Uridine + Orthophosphateuridine 5'-monophosphate phosphohydrolase
R00968 GTP + Uridine <=> GDP + UMPGTP:uridine 5'-phosphotransferase
R00970 ITP + Uridine <=> IDP + UMPITP:uridine 5'-phosphotransferase
R01876 Uridine + Orthophosphate <=> Uracil + alpha-D-Ribose 1-phosphateuridine:phosphate alpha-D-ribosyltransferase

Table of KEGG human pathways containing Uridine

Pathway IDHuman Pathway# of reactions
hsa00240 Pyrimidine metabolism 3
  logo