RefMet Compound Details
MW structure | 37186 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Xanthine | |
Systematic name | 2,3,6,7-tetrahydro-1H-purine-2,6-dione | |
SMILES | O=c1[nH]c(=O)c2nc[nH]c2[nH]1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 152.033426 (neutral) |
Table of KEGG reactions in human pathways involving Xanthine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02107 | Xanthine + H2O + Oxygen <=> Urate + Hydrogen peroxide | Xanthine:oxygen oxidoreductase |
R01768 | Hypoxanthine + NAD+ + H2O <=> Xanthine + NADH + H+ | hypoxanthine:NAD+ oxidoreductase |
R02297 | Xanthosine + Orthophosphate <=> Xanthine + alpha-D-Ribose 1-phosphate | Xanthosine:orthophosphate ribosyltransferase |
R02143 | Xanthosine + H2O <=> Xanthine + D-Ribose | Xanthosine ribohydrolase |
R01676 | Guanine + H2O <=> Xanthine + Ammonia | Guanine aminohydrolase |
R01769 | Hypoxanthine + Oxygen + H2O <=> Xanthine + Hydrogen peroxide | Hypoxanthine:oxygen oxidoreductase |
R02142 | Xanthosine 5'-phosphate + Diphosphate <=> Xanthine + 5-Phospho-alpha-D-ribose 1-diphosphate | XMP:pyrophosphate phosphoribosyltransferase |
R02103 | Xanthine + NAD+ + H2O <=> Urate + NADH + H+ | xanthine:NAD+ oxidoreductase |
Table of KEGG human pathways containing Xanthine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 7 |
hsa01100 | Metabolic pathways | 1 |