RefMet Compound Details
MW structure | 37187 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Xanthosine 5-triphosphate | |
Systematic name | ({[({[(2R,3S,4R,5R)-5-(2,6-dihydroxy-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid | |
SMILES | C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c2[nH]c(=O)[nH]c3=O)O1)O)O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 523.974675 (neutral) |
Table of KEGG reactions in human pathways involving Xanthosine 5-triphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02805 | P1,P4-Bis(5'-xanthosyl) tetraphosphate + H2O <=> XTP + Xanthosine 5'-phosphate | P1,P4-Bis(5'-nucleosyl)-tetraphosphate nucleotidohydrolase |
R02720 | XTP + H2O <=> Xanthosine 5'-phosphate + Diphosphate | XTP pyrophosphohydrolase |
Table of KEGG human pathways containing Xanthosine 5-triphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 2 |