RefMet Compound Details
MW structure | 37074 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Xylose | |
Systematic name | (3R,4S,5R)-oxane-2,3,4,5-tetrol | |
SMILES | C1[C@H]([C@@H]([C@H](C(O)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 150.052825 (neutral) |
Table of KEGG reactions in human pathways involving Xylose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07152 | Xylitol + Oxygen <=> D-Xylose + Hydrogen peroxide | xylitol:oxygen oxidoreductase |
R01431 | Xylitol + NADP+ <=> D-Xylose + NADPH + H+ | xylitol:NADP+ oxidoreductase |
R01430 | D-Xylose + NADP+ <=> D-Xylonolactone + NADPH + H+ | D-xylose:NADP+ 1-oxidoreductase |
R01429 | D-Xylose + NAD+ <=> D-Xylonolactone + NADH + H+ | D-xylose:NAD+ 1-oxidoreductase |
R09477 | Xylitol + NAD+ <=> D-Xylose + NADH + H+ | xylitol:NAD+ oxidoreductase |
Table of KEGG human pathways containing Xylose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 3 |
hsa00040 | Pentose and glucuronate interconversions | 2 |