RefMet Compound Details
MW structure | 37878 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Xylulose | |
Systematic name | (3S,4R)-1,3,4,5-tetrahydroxypentan-2-one | |
SMILES | C([C@H]([C@@H](C(=O)CO)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 150.052825 (neutral) |
Table of KEGG reactions in human pathways involving Xylulose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01639 | ATP + D-Xylulose <=> ADP + D-Xylulose 5-phosphate | ATP:D-xylulose 5-phosphotransferase |
R01896 | Xylitol + NAD+ <=> D-Xylulose + NADH + H+ | xylitol:NAD+ 2-oxidoreductase (D-xylulose-forming) |
Table of KEGG human pathways containing Xylulose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00040 | Pentose and glucuronate interconversions | 2 |