RefMet Compound Details
MW structure | 78629 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | alpha-Hydroxytamoxifen | |
Systematic name | (E)-4-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-3-en-2-ol | |
SMILES | CC(/C(=C(\c1ccccc1)/c1ccc(cc1)OCCN(C)C)/c1ccccc1)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 387.219829 (neutral) |
Table of KEGG reactions in human pathways involving alpha-Hydroxytamoxifen
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08271 | Tamoxifen + NADPH + Oxygen + H+ <=> alpha-Hydroxytamoxifen + NADP+ + H2O | Tamoxifen + NADPH + Oxygen + H+ <=> alpha-Hydroxytamoxifen + NADP+ + H2O |
Table of KEGG human pathways containing alpha-Hydroxytamoxifen
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00982 | Drug metabolism - cytochrome P450 | 1 |