RefMet Compound Details
MW structure | 35273 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | beta-Estradiol | |
Systematic name | estra-1,3,5(10)-triene-3,17beta-diol | |
SMILES | C[C@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1CC[C@@H]2O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 18:3;O2 | View other entries in RefMet with this sum composition |
Exact mass | 272.177630 (neutral) |
Table of KEGG reactions in human pathways involving beta-Estradiol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02353 | Estradiol-17beta + NADP+ <=> Estrone + NADPH + H+ | Estradiol-17beta:NADP+ 17-oxidoreductase |
R03088 | Estradiol-17beta + H+ + Oxygen + NADH <=> 2-Hydroxyestradiol + NAD+ + H2O | Estradiol-17beta + H+ + Oxygen + NADH <=> 2-Hydroxyestradiol + NAD+ + H2O |
R03091 | Estradiol-17beta + UDP-glucuronate <=> Estradiol-17beta 3-glucuronide + UDP | UDPglucuronate beta-D-glucuronosyltransferase(acceptor-unspecific) |
R02352 | Estradiol-17beta + NAD+ <=> Estrone + NADH + H+ | Estradiol-17beta:NAD+ 17-oxidoreductase |
R03089 | Estradiol-17beta + H+ + Oxygen + NADPH <=> Estriol + NADP+ + H2O | Estradiol-17beta + H+ + Oxygen + NADPH <=> Estriol + NADP+ + H2O |
R03087 | 19-Oxotestosterone + Oxygen + [Reduced NADPH---hemoprotein reductase] <=> Estradiol-17beta + Formate + [Oxidized NADPH---hemoprotein reductase] + H2O | 19-oxotestosterone,NADPH---hemoprotein reductase:oxygen oxidoreductase (aromatizing, formate-forming) |
R03090 | Estradiol-17beta + H+ + Oxygen + NADPH <=> 2-Hydroxyestradiol + NADP+ + H2O | Estradiol-17beta + H+ + Oxygen + NADPH <=> 2-Hydroxyestradiol + NADP+ + H2O |
Table of KEGG human pathways containing beta-Estradiol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 7 |
hsa01100 | Metabolic pathways | 2 |