RefMet Compound Details
MW structure | 37495 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dAMP | |
Systematic name | {[(2R,3S,5R)-5-(6-amino-9H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy}phosphonic acid | |
SMILES | C1[C@@H]([C@@H](COP(=O)(O)O)O[C@H]1n1cnc2c(N)ncnc12)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 331.068173 (neutral) |
Table of KEGG reactions in human pathways involving dAMP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01547 | ATP + dAMP <=> ADP + dADP | ATP:dAMP phosphotransferase |
R02089 | ATP + Deoxyadenosine <=> ADP + dAMP | ATP:deoxyadenosine 5'-phosphotransferase |
R02088 | dAMP + H2O <=> Deoxyadenosine + Orthophosphate | 2'-deoxyadenosine 5'-monophosphate phosphohydrolase |
Table of KEGG human pathways containing dAMP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 3 |
hsa01100 | Metabolic pathways | 1 |
hsa01232 | Nucleotide metabolism | 1 |