RefMet Compound Details
MW structure | 37660 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dCMP | |
Systematic name | {[(2R,3S,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy}phosphonic acid | |
SMILES | c1cn([C@H]2C[C@@H]([C@@H](COP(=O)(O)O)O2)O)c(=O)nc1N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 307.056940 (neutral) |
Table of KEGG reactions in human pathways involving dCMP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01664 | dCMP + H2O <=> Deoxycytidine + Orthophosphate | 2'-deoxycytidine 5'-monophosphate phosphohydrolase |
R01668 | dCTP + H2O <=> dCMP + Diphosphate | dCTP nucleotidohydrolase |
R01666 | ATP + Deoxycytidine <=> ADP + dCMP | ATP:deoxycitidine 5'-phosphotransferase |
R01663 | dCMP + H2O <=> dUMP + Ammonia | dCMP aminohydrolase |
R01667 | dCDP + H2O <=> dCMP + Orthophosphate | dCDP nucleotidohydrolase |
R01665 | ATP + dCMP <=> ADP + dCDP | ATP:dCMP phosphotransferase |
Table of KEGG human pathways containing dCMP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 6 |