RefMet Compound Details
MW structure | 50227 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dTDP-glucose | |
Systematic name | thymidine 5'-[3-(alpha-D-glucopyranosyl) dihydrogen diphosphate] | |
SMILES | Cc1cn([C@H]2C[C@@H]([C@@H](COP(=O)(O)OP(=O)(O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O2)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 564.075764 (neutral) |
Table of KEGG reactions in human pathways involving dTDP-glucose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R06513 | dTDP-glucose <=> dTDP-4-oxo-6-deoxy-D-glucose + H2O | dTDPglucose 4,6-hydro-lyase |
Table of KEGG human pathways containing dTDP-glucose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 1 |
hsa01250 | Biosynthesis of nucleotide sugars | 1 |