RefMet Compound Details
MW structure | 37738 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dTTP | |
Systematic name | 2'-Deoxythymidine triphosphate | |
SMILES | Cc1cn([C@H]2C[C@@H]([C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 481.989272 (neutral) |
Table of KEGG reactions in human pathways involving dTTP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02093 | ATP + dTDP <=> ADP + dTTP | ATP:dTDP phosphotransferase |
R02095 | dTTP + H2O <=> dTDP + Orthophosphate | dTTP nucleotidohydrolase |
R11323 | dTTP + H2O <=> dTMP + Diphosphate | dTTP diphosphohydrolase |
Table of KEGG human pathways containing dTTP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 3 |