RefMet Compound Details
MW structure | 73611 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | trans-4-Hydroxyproline | |
Systematic name | Trans-4-hydroxy-L-proline | |
SMILES | C1[C@H](CN[C@@H]1C(=O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 131.058244 (neutral) |
Table of KEGG reactions in human pathways involving trans-4-Hydroxyproline
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03293 | Hydroxyproline + NADP+ <=> L-1-Pyrroline-3-hydroxy-5-carboxylate + NADPH + H+ | trans-4-Hydroxy-L-proline:NADP+ 5-oxidoreductase |
R01252 | L-Proline + 2-Oxoglutarate + Oxygen <=> Hydroxyproline + Succinate + CO2 | L-Proline,2-oxoglutarate:oxygen oxidoreductase (4-hydroxylating) |
R03291 | Hydroxyproline + NAD+ <=> L-1-Pyrroline-3-hydroxy-5-carboxylate + NADH + H+ | trans-4-Hydroxy-L-proline:NAD+ 5-oxidoreductase |
R03295 | Hydroxyproline + Quinone <=> L-1-Pyrroline-3-hydroxy-5-carboxylate + Hydroquinone | trans-4-hydroxy-L-proline:quinone oxidoreductase |
Table of KEGG human pathways containing trans-4-Hydroxyproline
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00330 | Arginine and proline metabolism | 4 |
hsa01100 | Metabolic pathways | 2 |