RefMet Compound Details
MW structure | 35390 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 11-Deoxycortisol | |
Systematic name | 17,21-dihydroxypregn-4-ene-3,20-dione | |
SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(C(=O)CO)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:3;O4 | View other entries in RefMet with this sum composition |
Exact mass | 346.214410 (neutral) |
Table of KEGG reactions in human pathways involving 11-Deoxycortisol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02843 | 11-Deoxycortisol + 2 Reduced ferredoxin + Oxygen + 2 H+ <=> Cortisol + 2 Oxidized ferredoxin + H2O | steroid,reduced ferredoxin:oxygen oxidoreductase (11-hydroxylating) |
R03326 | 17alpha-Hydroxyprogesterone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 11-Deoxycortisol + [Oxidized NADPH---hemoprotein reductase] + H2O | 17alpha-hydroxyprogesterone,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating) |
R04849 | 11-Deoxycortisol + H+ + NADH <=> 17alpha,21-Dihydroxypregnenolone + NAD+ | 11-Deoxycortisol delta5-delat4-isomerase |
Table of KEGG human pathways containing 11-Deoxycortisol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |