RefMet Compound Details
MW structure | 2762 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 14,15-Ep-11-HETrE | |
Systematic name | 11-hydroxy-14,15-epoxy-5Z,8Z,12E-eicosatrienoic acid | |
SMILES | CCCCCC1C(/C=C/C(C/C=C\C/C=C\CCCC(=O)O)O)O1 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 336.230060 (neutral) |
Table of KEGG reactions in human pathways involving 14,15-Ep-11-HETrE
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07043 | 15(S)-HPETE <=> 11H-14,15-EETA | 15(S)-HPETE <=> 11H-14,15-EETA |
R07045 | 11H-14,15-EETA + H2O <=> 11,14,15-THETA | 11H-14,15-EETA + H2O <=> 11,14,15-THETA |
Table of KEGG human pathways containing 14,15-Ep-11-HETrE
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00590 | Arachidonic acid metabolism | 2 |