RefMet Compound Details
MW structure | 50687 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 2-Aminomuconic acid | |
Systematic name | 2-aminohexa-2,4-dienedioic acid | |
SMILES | C(=C\C(=O)O)/C=C(/C(=O)O)\N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 157.037509 (neutral) |
Table of KEGG reactions in human pathways involving 2-Aminomuconic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03889 | 2-Aminomuconate semialdehyde + NAD+ + H2O <=> 2-Aminomuconate + H+ + NADH | 2-Aminomuconate semialdehyde:NAD+ 6-oxidoreductase |
Table of KEGG human pathways containing 2-Aminomuconic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 1 |